TensorFlow 2.14 Graph Neural Networks: Building GNNs for Drug Discovery

Learn how to implement Graph Neural Networks with TensorFlow 2.14 for drug discovery applications with practical code examples and visualization techniques.

What You'll Learn

  • How to implement Graph Neural Networks using TensorFlow 2.14
  • Methods to represent molecular structures as graphs
  • Practical code for building a GNN model for drug discovery
  • Techniques to predict molecular properties accurately
  • Ways to visualize molecular graphs and model predictions

Introduction

Graph Neural Networks (GNNs) excel at analyzing molecular structures for drug discovery. TensorFlow 2.14 offers specific tools to build these networks efficiently, allowing researchers to predict how drug candidates interact with biological targets.

Drug discovery research faces high costs and lengthy timelines. Machine learning approaches like GNNs help reduce both by accurately screening compounds before expensive lab testing. TensorFlow 2.14's GNN implementation makes this technology accessible to more researchers.

This guide shows you how to build a GNN for drug discovery using TensorFlow 2.14, from data preparation to model evaluation.

What Are Graph Neural Networks?

Graph Neural Networks process data represented as graphs—collections of nodes connected by edges. For molecules, atoms become nodes and chemical bonds become edges.

GNNs work by:

  1. Taking initial features for each node (atom)
  2. Passing messages between connected nodes through multiple layers
  3. Updating node representations based on their neighbors
  4. Generating final predictions from the processed graph

This message-passing architecture captures the structural relationships in molecules that determine their properties and biological activity.

Setting Up Your Environment

First, install the necessary packages:

pip install tensorflow==2.14.0
pip install tensorflow-gnn
pip install rdkit
pip install matplotlib
pip install scikit-learn
pip install pandas
pip install numpy

Import the required libraries:

import tensorflow as tf
import tensorflow_gnn as tfgnn
import numpy as np
import pandas as pd
from rdkit import Chem
from rdkit.Chem import AllChem
from rdkit.Chem import Draw
import matplotlib.pyplot as plt
from sklearn.model_selection import train_test_split

Representing Molecules as Graphs

The foundation of GNN-based drug discovery is converting molecular structures into graph format. We'll use RDKit to process SMILES strings (a text representation of molecules) into graph data:

def smiles_to_graph(smiles):
    """Convert a SMILES string to a molecular graph."""
    # Parse SMILES string to molecule
    mol = Chem.MolFromSmiles(smiles)
    
    # Get atom features
    atom_features = []
    for atom in mol.GetAtoms():
        features = [
            atom.GetAtomicNum(),  # Atomic number
            atom.GetTotalDegree(),  # Number of bonds
            atom.GetFormalCharge(),  # Formal charge
            atom.GetNumRadicalElectrons(),  # Number of radical electrons
            atom.GetHybridization(),  # Hybridization state
            atom.GetIsAromatic(),  # Aromaticity flag
            atom.IsInRing()  # Ring status
        ]
        atom_features.append(features)
    
    # Get bond information (edges)
    bonds = []
    for bond in mol.GetBonds():
        start, end = bond.GetBeginAtomIdx(), bond.GetEndAtomIdx()
        # Add both directions for undirected graph
        bonds.append([start, end, bond.GetBondTypeAsDouble()])
        bonds.append([end, start, bond.GetBondTypeAsDouble()])
    
    return {
        'atom_features': np.array(atom_features, dtype=np.float32),
        'bonds': np.array(bonds, dtype=np.int32) if bonds else np.zeros((0, 3), dtype=np.int32)
    }

Building a TensorFlow GNN Dataset

To train our model, we need to convert our molecular graphs into TensorFlow's GraphTensor format:

def create_graph_tensor(graph_dict):
    """Convert graph dictionary to GraphTensor."""
    
    # Create node features
    node_features = tf.convert_to_tensor(graph_dict['atom_features'], dtype=tf.float32)
    
    # Create edge connections
    if graph_dict['bonds'].shape[0] > 0:
        edge_src = graph_dict['bonds'][:, 0]
        edge_dst = graph_dict['bonds'][:, 1]
        edge_weight = tf.convert_to_tensor(graph_dict['bonds'][:, 2], dtype=tf.float32)
        edge_weight = tf.reshape(edge_weight, [-1, 1])
    else:
        # Handle molecules with no bonds
        edge_src = tf.zeros([0], dtype=tf.int32)
        edge_dst = tf.zeros([0], dtype=tf.int32)
        edge_weight = tf.zeros([0, 1], dtype=tf.float32)
    
    # Create graph context
    num_nodes = tf.shape(node_features)[0]
    
    # Build adjacency for edges
    edge_adjacency = tfgnn.Adjacency.from_indices(
        source=("atom", edge_src),
        target=("atom", edge_dst)
    )
    
    # Create the graph tensor
    return tfgnn.GraphTensor.from_pieces(
        context=tfgnn.Context.from_fields(features={}),
        node_sets={
            "atom": tfgnn.NodeSet.from_fields(
                features={"features": node_features},
                sizes=tf.expand_dims(num_nodes, axis=0)
            )
        },
        edge_sets={
            "bond": tfgnn.EdgeSet.from_fields(
                features={"weight": edge_weight},
                adjacency=edge_adjacency,
                sizes=tf.expand_dims(tf.shape(edge_src)[0], axis=0)
            )
        }
    )

Sample Dataset Preparation

For this tutorial, we'll use a subset of the ESOL dataset which contains water solubility measurements for small molecules:

# Sample data (SMILES strings and solubility values)
data = {
    'SMILES': [
        'CN1C=NC2=C1C(=O)N(C(=O)N2C)C', # Caffeine
        'CC(=O)OC1=CC=CC=C1C(=O)O',      # Aspirin
        'CC1=C(C=C(C=C1)S(=O)(=O)N)CC(=O)N', # Tolbutamide
        'C1=CC=C2C(=C1)C=CC=C2',         # Naphthalene
        'CCO',                           # Ethanol
    ],
    'Solubility': [-0.07, -1.31, -3.47, -3.30, 0.18]
}

df = pd.DataFrame(data)

# Convert SMILES to graphs
graphs = [smiles_to_graph(smiles) for smiles in df['SMILES']]

# Create tensorflow dataset
X = [create_graph_tensor(g) for g in graphs]
y = df['Solubility'].values

# Split the data
X_train, X_test, y_train, y_test = train_test_split(X, y, test_size=0.2, random_state=42)

# Create TensorFlow datasets
def create_tf_dataset(graphs, labels, batch_size=32):
    dataset = tf.data.Dataset.from_tensor_slices((graphs, labels))
    return dataset.batch(batch_size)

train_dataset = create_tf_dataset(X_train, y_train)
test_dataset = create_tf_dataset(X_test, y_test)

Building a Graph Neural Network Model

Now let's build our GNN model for drug property prediction:

def build_gnn_model():
    """Build a Graph Neural Network model for molecular property prediction."""
    
    # Define the input GraphTensor spec
    graph_spec = tfgnn.GraphTensorSpec.from_piece_specs(
        node_sets_spec={
            "atom": tfgnn.NodeSetSpec.from_field_specs(
                features_spec={"features": tf.TensorSpec(shape=[None, 7], dtype=tf.float32)},
                size_spec=tf.TensorSpec(shape=[1], dtype=tf.int32)
            )
        },
        edge_sets_spec={
            "bond": tfgnn.EdgeSetSpec.from_field_specs(
                features_spec={"weight": tf.TensorSpec(shape=[None, 1], dtype=tf.float32)},
                adjacency_spec=tfgnn.AdjacencySpec.from_indices_spec(
                    source=("atom", tf.TensorSpec(shape=[None], dtype=tf.int32)),
                    target=("atom", tf.TensorSpec(shape=[None], dtype=tf.int32))
                ),
                size_spec=tf.TensorSpec(shape=[1], dtype=tf.int32)
            )
        },
        context_spec=tfgnn.ContextSpec.from_field_specs(
            features_spec={},
            size_spec=tf.TensorSpec(shape=[1], dtype=tf.int32)
        )
    )
    
    # Create model input
    graph_input = tf.keras.layers.Input(type_spec=graph_spec)
    graph = graph_input
    
    # Initial node embedding
    graph = tfgnn.keras.layers.MapFeatures(
        node_sets_fn=lambda node_set, *, node_set_name: tf.keras.layers.Dense(64, activation="relu")(node_set["features"])
    )(graph)
    
    # Two Graph Conv layers
    for _ in range(2):
        # Message passing
        graph = tfgnn.keras.layers.GraphUpdate(
            node_sets={
                "atom": tfgnn.keras.layers.NodeSetUpdate(
                    {
                        "bond": tfgnn.keras.layers.SimpleConv(
                            sender_edge_feature="weight",
                            receiver_tag=tfgnn.TARGET,
                            message_fn=tf.keras.layers.Dense(64, activation="relu")
                        )
                    },
                    next_state=tf.keras.layers.Dense(64, activation="relu")
                )
            }
        )(graph)
    
    # Global readout (mean pooling)
    pooled = tfgnn.keras.layers.Pool(
        node_set_name="atom",
        reduce_type="mean"
    )(graph)
    
    # Output layer
    output = tf.keras.layers.Dense(1)(pooled)
    
    # Create the model
    model = tf.keras.Model(inputs=graph_input, outputs=output)
    model.compile(
        optimizer=tf.keras.optimizers.Adam(learning_rate=0.001),
        loss=tf.keras.losses.MeanSquaredError(),
        metrics=[tf.keras.metrics.MeanAbsoluteError()]
    )
    
    return model

Training the GNN Model

With our model defined, we can now train it on our molecular dataset:

model = build_gnn_model()

# Train the model
history = model.fit(
    train_dataset,
    validation_data=test_dataset,
    epochs=50,
    verbose=1
)

# Plot training history
plt.figure(figsize=(10, 6))
plt.plot(history.history['loss'], label='Training Loss')
plt.plot(history.history['val_loss'], label='Validation Loss')
plt.title('Model Loss During Training')
plt.xlabel('Epoch')
plt.ylabel('Loss')
plt.legend()
plt.show()

Visualizing Molecular Graphs

Understanding the input to our GNN is crucial. Let's create a visualization function for our molecular graphs:

def visualize_molecule(smiles, prediction=None, actual=None):
    """Create a visualization of a molecule with optional prediction results."""
    mol = Chem.MolFromSmiles(smiles)
    
    # Compute 2D coordinates for the molecule
    mol = Chem.AddHs(mol)
    AllChem.EmbedMolecule(mol)
    AllChem.MMFFOptimizeMolecule(mol)
    mol = Chem.RemoveHs(mol)
    
    # Create the drawing
    fig, ax = plt.subplots(figsize=(8, 6))
    
    # Draw the molecule
    drawer = Draw.MolDraw2DCairo(400, 300)
    drawer.DrawMolecule(mol)
    drawer.FinishDrawing()
    img = drawer.GetDrawingText()
    
    # Display the image
    from IPython.display import Image, display
    display(Image(img))
    
    # Add prediction information if provided
    title = "Molecular Structure"
    if prediction is not None and actual is not None:
        print(f"Predicted Solubility: {prediction:.2f}")
        print(f"Actual Solubility: {actual:.2f}")
        print(f"Error: {abs(prediction - actual):.2f}")
    
    return fig

Making Predictions

Now we can make predictions on new molecules:

def predict_solubility(smiles, model):
    """Predict solubility for a given SMILES string."""
    # Convert to graph
    graph_dict = smiles_to_graph(smiles)
    graph_tensor = create_graph_tensor(graph_dict)
    
    # Add batch dimension
    batched_tensor = tf.expand_dims(graph_tensor, 0)
    
    # Make prediction
    prediction = model.predict(batched_tensor)
    return prediction[0][0]

# Example prediction
test_smiles = "C1=CC=CC=C1O"  # Phenol
predicted_solubility = predict_solubility(test_smiles, model)
print(f"Predicted solubility of phenol: {predicted_solubility:.2f}")

# Visualize the molecule
visualize_molecule(test_smiles, prediction=predicted_solubility)

Advanced GNN Techniques for Drug Discovery

Beyond basic GNNs, several advanced techniques improve performance for drug discovery:

  • Attention Mechanisms: Weight different parts of the molecular structure based on their importance for the property prediction.

  • Edge Features: Use detailed bond information (bond type, length, angle) to better represent molecular structures.

  • Transfer Learning: Pre-train GNNs on large molecular datasets, then fine-tune for specific properties.

  • Multi-task Learning: Predict multiple properties simultaneously, allowing the model to learn shared representations.

Sample Implementation of Attention-based GNN

Here's a more advanced model using attention mechanisms:

def build_attention_gnn_model():
    """Build an attention-based GNN for molecular property prediction."""
    
    # Define the input GraphTensor spec (same as before)
    graph_spec = tfgnn.GraphTensorSpec.from_piece_specs(
        # ... (same as before)
    )
    
    # Create model input
    graph_input = tf.keras.layers.Input(type_spec=graph_spec)
    graph = graph_input
    
    # Initial node embedding
    graph = tfgnn.keras.layers.MapFeatures(
        node_sets_fn=lambda node_set, *, node_set_name: tf.keras.layers.Dense(64, activation="relu")(node_set["features"])
    )(graph)
    
    # Custom attention-based message passing
    def attention_message_fn(sender_node_embedding, sender_edge_embedding, receiver_node_embedding):
        # Compute attention scores
        sender_info = tf.concat([sender_node_embedding, sender_edge_embedding], axis=-1)
        message = tf.keras.layers.Dense(64, activation="relu")(sender_info)
        
        # Compute attention weights
        attention_score = tf.keras.layers.Dense(1, activation="sigmoid")(
            tf.concat([message, receiver_node_embedding], axis=-1)
        )
        
        # Apply attention weights to message
        weighted_message = message * attention_score
        return weighted_message
    
    # Implement attention-based graph update
    for _ in range(3):  # Deeper network
        # Message passing with attention
        graph = tfgnn.keras.layers.GraphUpdate(
            node_sets={
                "atom": tfgnn.keras.layers.NodeSetUpdate(
                    {
                        "bond": tfgnn.keras.layers.SimpleConv(
                            sender_edge_feature="weight",
                            receiver_tag=tfgnn.TARGET,
                            message_fn=tf.keras.Sequential([
                                tf.keras.layers.Dense(64, activation="relu"),
                                tf.keras.layers.Dense(64, activation="tanh")
                            ])
                        )
                    },
                    next_state=tf.keras.layers.Dense(64, activation="relu")
                )
            }
        )(graph)
    
    # Hierarchical pooling
    pooled = tfgnn.keras.layers.Pool(
        node_set_name="atom",
        reduce_type="mean"
    )(graph)
    
    # Output MLP
    x = tf.keras.layers.Dense(32, activation="relu")(pooled)
    x = tf.keras.layers.Dropout(0.2)(x)
    output = tf.keras.layers.Dense(1)(x)
    
    # Create the model
    model = tf.keras.Model(inputs=graph_input, outputs=output)
    model.compile(
        optimizer=tf.keras.optimizers.Adam(learning_rate=0.001),
        loss=tf.keras.losses.MeanSquaredError(),
        metrics=[tf.keras.metrics.MeanAbsoluteError()]
    )
    
    return model

Evaluating GNN Performance

To properly evaluate our model's performance for drug discovery applications:

def evaluate_model(model, test_dataset, test_smiles, test_values):
    """Evaluate model performance with metrics relevant to drug discovery."""
    
    # Standard evaluation
    results = model.evaluate(test_dataset, verbose=0)
    print(f"Test Loss (MSE): {results[0]:.4f}")
    print(f"Test MAE: {results[1]:.4f}")
    
    # Make individual predictions
    predictions = []
    for smiles in test_smiles:
        pred = predict_solubility(smiles, model)
        predictions.append(pred)
    
    predictions = np.array(predictions)
    
    # Calculate R² score
    from sklearn.metrics import r2_score
    r2 = r2_score(test_values, predictions)
    print(f"R² Score: {r2:.4f}")
    
    # Plot predicted vs actual
    plt.figure(figsize=(8, 8))
    plt.scatter(test_values, predictions)
    plt.plot([-5, 2], [-5, 2], 'r--')  # Diagonal line
    plt.xlabel('Actual Solubility')
    plt.ylabel('Predicted Solubility')
    plt.title('Predicted vs Actual Solubility')
    plt.axis('equal')
    plt.grid(True)
    plt.show()
    
    return predictions

Case Study: Predicting Solubility for Drug Candidates

Let's apply our model to predict properties for a set of potential drug candidates:

# Example drug candidates
candidates = [
    "CC(C)CC1=CC=C(C=C1)C(C)C(=O)O",  # Ibuprofen
    "CC(=O)OC1=CC=CC=C1C(=O)O",       # Aspirin
    "CCN(CC)CCOC(=O)C1=CC=CC=C1N",    # Procaine
    "CN1C=NC2=C1C(=O)N(C(=O)N2C)C",   # Caffeine
    "COC1=CC=C(C=C1)CCNC(C)C",        # Metoprolol
]

# Make predictions
candidate_predictions = []
for smiles in candidates:
    pred = predict_solubility(smiles, model)
    candidate_predictions.append(pred)
    print(f"Molecule: {smiles}")
    print(f"Predicted solubility: {pred:.2f}\n")
    visualize_molecule(smiles, prediction=pred, actual=None)

Conclusion

TensorFlow 2.14 Graph Neural Networks offer a powerful tool for drug discovery. This tutorial demonstrated how to build a GNN model that predicts molecular properties from structural data. The key advantages include:

  • Direct processing of graph-structured molecular data
  • Ability to capture complex structural patterns in molecules
  • Flexible architecture for different property prediction tasks
  • Effective use of message passing to model atom interactions

By implementing these techniques, researchers can screen potential drug candidates faster and more accurately, significantly reducing the time and cost of drug discovery projects.

Remember that while GNN models provide valuable insights, they should complement, not replace, experimental validation. The best drug discovery pipelines combine computational predictions with laboratory testing.

Additional Resources